C10H17BrS — CID 88907143
(2Z,6Z)-1-bromo-7-methylnona-2,6-diene-3-thiol (PubChem CID 88907143) has the molecular formula C10H17BrS and a molecular weight of 249.22 g/mol. Its IUPAC name is (2Z,6Z)-1-bromo-7-methylnona-2,6-diene-3-thiol.
| Compound Name | (2Z,6Z)-1-bromo-7-methylnona-2,6-diene-3-thiol |
|---|---|
| PubChem CID | 88907143 |
| Molecular Formula | C10H17BrS |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | (2Z,6Z)-1-bromo-7-methylnona-2,6-diene-3-thiol |
| SMILES | CC/C(C)=C\CC/C(S)=C/CBr |
| InChI | InChI=1S/C10H17BrS/c1-3-9(2)5-4-6-10(12)7-8-11/h5,7,12H,3-4,6,8H2,1-2H3/b9-5-,10-7- |
| InChIKey | CXLULSWHIMIIOK-IQHOYWBLSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|