C17H27BrO3 — CID 23584812
ethyl (6E,10E)-12-bromo-2,6,10-trimethyl-3-oxododeca-6,10-dienoate (PubChem CID 23584812) has the molecular formula C17H27BrO3 and a molecular weight of 359.30 g/mol. Its IUPAC name is ethyl (6E,10E)-12-bromo-2,6,10-trimethyl-3-oxododeca-6,10-dienoate.
| Compound Name | ethyl (6E,10E)-12-bromo-2,6,10-trimethyl-3-oxododeca-6,10-dienoate |
|---|---|
| PubChem CID | 23584812 |
| Molecular Formula | C17H27BrO3 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl (6E,10E)-12-bromo-2,6,10-trimethyl-3-oxododeca-6,10-dienoate |
| SMILES | CCOC(=O)C(C)C(=O)CC/C(C)=C/CC/C(C)=C/CBr |
| InChI | InChI=1S/C17H27BrO3/c1-5-21-17(20)15(4)16(19)10-9-13(2)7-6-8-14(3)11-12-18/h7,11,15H,5-6,8-10,12H2,1-4H3/b13-7+,14-11+ |
| InChIKey | CLKKLMNDZGJDDN-FYCHQBGDSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|