C27H32BrP — CID 87714786
(E)-1-bromo-3,6-dimethylhept-2-ene;triphenylphosphane (PubChem CID 87714786) has the molecular formula C27H32BrP and a molecular weight of 467.43 g/mol. Its IUPAC name is (E)-1-bromo-3,6-dimethylhept-2-ene;triphenylphosphane.
| Compound Name | (E)-1-bromo-3,6-dimethylhept-2-ene;triphenylphosphane |
|---|---|
| PubChem CID | 87714786 |
| Molecular Formula | C27H32BrP |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | (E)-1-bromo-3,6-dimethylhept-2-ene;triphenylphosphane |
| SMILES | C/C(=C\CBr)CCC(C)C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C9H17Br/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8(2)4-5-9(3)6-7-10/h1-15H;6,8H,4-5,7H2,1-3H3/b;9-6+ |
| InChIKey | LOOYBTFIMQNLEE-RRJFPGPQSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|