C16H26O2 — CID 102001360
(5E,7E,11R)-11-methoxy-8-methyltetradeca-5,7,13-trienal (PubChem CID 102001360) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (5E,7E,11R)-11-methoxy-8-methyltetradeca-5,7,13-trienal.
| Compound Name | (5E,7E,11R)-11-methoxy-8-methyltetradeca-5,7,13-trienal |
|---|---|
| PubChem CID | 102001360 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (5E,7E,11R)-11-methoxy-8-methyltetradeca-5,7,13-trienal |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CCCC=O)OC |
| InChI | InChI=1S/C16H26O2/c1-4-10-16(18-3)13-12-15(2)11-8-6-5-7-9-14-17/h4,6,8,11,14,16H,1,5,7,9-10,12-13H2,2-3H3/b8-6+,15-11+/t16-/m0/s1 |
| InChIKey | LDJUNXJFCLIBLM-UPKSXNSASA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|