C20H38O2Si — CID 10903884
(4R,7E,9E)-13-[tert-butyl(dimethyl)silyl]oxy-7-methyltrideca-1,7,9-trien-4-ol (PubChem CID 10903884) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is (4R,7E,9E)-13-[tert-butyl(dimethyl)silyl]oxy-7-methyltrideca-1,7,9-trien-4-ol.
| Compound Name | (4R,7E,9E)-13-[tert-butyl(dimethyl)silyl]oxy-7-methyltrideca-1,7,9-trien-4-ol |
|---|---|
| PubChem CID | 10903884 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (4R,7E,9E)-13-[tert-butyl(dimethyl)silyl]oxy-7-methyltrideca-1,7,9-trien-4-ol |
| SMILES | C=CC[C@H](O)CC/C(C)=C/C=C/CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O2Si/c1-8-13-19(21)16-15-18(2)14-11-9-10-12-17-22-23(6,7)20(3,4)5/h8-9,11,14,19,21H,1,10,12-13,15-17H2,2-7H3/b11-9+,18-14+/t19-/m0/s1 |
| InChIKey | QEVOUTPWJQVQIQ-ARDHWVBJSA-N |
| XLogP | 6.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|