C42H64O7Si — CID 59850518
(E,2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-11-oxooctadec-3-enoic acid (PubChem CID 59850518) has the molecular formula C42H64O7Si and a molecular weight of 709.05 g/mol. Its IUPAC name is (E,2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-11-oxooctadec-3-enoic acid.
| Compound Name | (E,2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-11-oxooctadec-3-enoic acid |
|---|---|
| PubChem CID | 59850518 |
| Molecular Formula | C42H64O7Si |
| Molecular Weight | 709.05 g/mol |
| Exact Mass | 708.44 |
| IUPAC Name | (E,2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-11-oxooctadec-3-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)O)[C@@](O)(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H64O7Si/c1-8-9-10-13-18-25-34(43)26-19-14-11-12-15-24-31-37(38(44)45)42(47,39(46)49-40(2,3)4)32-33-48-50(41(5,6)7,35-27-20-16-21-28-35)36-29-22-17-23-30-36/h16-17,20-24,27-31,37,47H,8-15,18-19,25-26,32-33H2,1-7H3,(H,44,45)/b31-24+/t37-,42+/m1/s1 |
| InChIKey | YHIXMXMXCTUATK-WLKNZPFDSA-N |
| XLogP | 8.55 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.05 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|