C44H69NO8 — CID 59850498
tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoate (PubChem CID 59850498) has the molecular formula C44H69NO8 and a molecular weight of 740.04 g/mol. Its IUPAC name is tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoate.
| Compound Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoate |
|---|---|
| PubChem CID | 59850498 |
| Molecular Formula | C44H69NO8 |
| Molecular Weight | 740.04 g/mol |
| Exact Mass | 739.50 |
| IUPAC Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CCC)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C44H69NO8/c1-10-13-15-18-21-24-35(46)25-22-19-16-17-20-23-26-37(44(50,31-12-3)41(49)53-43(7,8)9)39(47)45-38(40(48)52-42(4,5)6)33-34-27-29-36(30-28-34)51-32-14-11-2/h23,26-30,37-38,50H,10,12-13,15-22,24-25,31-33H2,1-9H3,(H,45,47)/b26-23+/t37-,38+,44+/m1/s1 |
| InChIKey | SDYOBUPKJNDDCW-PDTNJKEASA-N |
| XLogP | 8.77 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.04 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|