C40H59NO11 — CID 118260096
tert-butyl (E,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-(2-methoxy-2-oxoethoxy)-1-oxopropan-2-yl]carbamoyl]-2,2-dihydroxy-12-oxononadec-4-enoate (PubChem CID 118260096) has the molecular formula C40H59NO11 and a molecular weight of 729.91 g/mol. Its IUPAC name is tert-butyl (E,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-(2-methoxy-2-oxoethoxy)-1-oxopropan-2-yl]carbamoyl]-2,2-dihydroxy-12-oxononadec-4-enoate.
| Compound Name | tert-butyl (E,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-(2-methoxy-2-oxoethoxy)-1-oxopropan-2-yl]carbamoyl]-2,2-dihydroxy-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 118260096 |
| Molecular Formula | C40H59NO11 |
| Molecular Weight | 729.91 g/mol |
| Exact Mass | 729.41 |
| IUPAC Name | tert-butyl (E,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-(2-methoxy-2-oxoethoxy)-1-oxopropan-2-yl]carbamoyl]-2,2-dihydroxy-12-oxononadec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)C(O)(O)C(=O)OC(C)(C)C)C(=O)OCC(=O)OC)cc1 |
| InChI | InChI=1S/C40H59NO11/c1-7-9-11-14-17-20-31(42)21-18-15-12-13-16-19-22-33(40(47,48)38(46)52-39(3,4)5)36(44)41-34(37(45)51-29-35(43)49-6)28-30-23-25-32(26-24-30)50-27-10-8-2/h19,22-26,33-34,47-48H,7,9,11-18,20-21,27-29H2,1-6H3,(H,41,44)/b22-19+/t33-,34+/m1/s1 |
| InChIKey | WAHAFSODRXIFRJ-AKSWWYTGSA-N |
| XLogP | 5.30 |
| TPSA | 174.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|