C39H56N2O11 — CID 118157683
(2S)-2-[(E,2S)-1-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(dimethylamino)-2-oxoethoxy]-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 118157683) has the molecular formula C39H56N2O11 and a molecular weight of 728.88 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-1-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(dimethylamino)-2-oxoethoxy]-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2S)-1-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(dimethylamino)-2-oxoethoxy]-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 118157683 |
| Molecular Formula | C39H56N2O11 |
| Molecular Weight | 728.88 g/mol |
| Exact Mass | 728.39 |
| IUPAC Name | (2S)-2-[(E,2S)-1-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(dimethylamino)-2-oxoethoxy]-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CC(=O)O)C(=O)O)C(=O)OCC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C39H56N2O11/c1-5-7-9-12-15-18-30(42)19-16-13-10-11-14-17-20-32(39(50,38(48)49)27-35(44)45)36(46)40-33(37(47)52-28-34(43)41(3)4)26-29-21-23-31(24-22-29)51-25-8-6-2/h17,20-24,32-33,50H,5,7,9-16,18-19,25-28H2,1-4H3,(H,40,46)(H,44,45)(H,48,49)/b20-17+/t32-,33+,39+/m1/s1 |
| InChIKey | XXWXCDYMMGWXKQ-JBPGSZOSSA-N |
| XLogP | 4.48 |
| TPSA | 196.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|