C40H60N2O9 — CID 118157591
(E,2S,3S)-2-[2-(butylamino)-2-oxoethyl]-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid (PubChem CID 118157591) has the molecular formula C40H60N2O9 and a molecular weight of 712.93 g/mol. Its IUPAC name is (E,2S,3S)-2-[2-(butylamino)-2-oxoethyl]-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-2-[2-(butylamino)-2-oxoethyl]-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118157591 |
| Molecular Formula | C40H60N2O9 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.43 |
| IUPAC Name | (E,2S,3S)-2-[2-(butylamino)-2-oxoethyl]-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CC(=O)NCCCC)C(=O)O)C(=O)OC)cc1 |
| InChI | InChI=1S/C40H60N2O9/c1-5-8-11-14-17-20-32(43)21-18-15-12-13-16-19-22-34(40(49,39(47)48)30-36(44)41-27-9-6-2)37(45)42-35(38(46)50-4)29-31-23-25-33(26-24-31)51-28-10-7-3/h19,22-26,34-35,49H,5-6,8-9,11-18,20-21,27-30H2,1-4H3,(H,41,44)(H,42,45)(H,47,48)/b22-19+/t34-,35+,40+/m1/s1 |
| InChIKey | MGWPZNFEJVAQDC-IWIXMASTSA-N |
| XLogP | 5.85 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|