C36H52N2O9 — CID 118157845
(E,2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid (PubChem CID 118157845) has the molecular formula C36H52N2O9 and a molecular weight of 656.82 g/mol. Its IUPAC name is (E,2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118157845 |
| Molecular Formula | C36H52N2O9 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.37 |
| IUPAC Name | (E,2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CC(N)=O)C(=O)O)C(=O)OC)cc1 |
| InChI | InChI=1S/C36H52N2O9/c1-4-6-8-11-14-17-28(39)18-15-12-9-10-13-16-19-30(36(45,35(43)44)26-32(37)40)33(41)38-31(34(42)46-3)25-27-20-22-29(23-21-27)47-24-7-5-2/h16,19-23,30-31,45H,4,6,8-15,17-18,24-26H2,1-3H3,(H2,37,40)(H,38,41)(H,43,44)/b19-16+/t30-,31+,36+/m1/s1 |
| InChIKey | IFWWNZDLKNKLCU-LOQQGKBVSA-N |
| XLogP | 4.42 |
| TPSA | 182.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|