C45H69NO14 — CID 123303884
(2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(2-methoxyethoxy)ethoxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]-2-oxoethyl]-12-oxononadec-4-enoic acid (PubChem CID 123303884) has the molecular formula C45H69NO14 and a molecular weight of 848.04 g/mol. Its IUPAC name is (2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(2-methoxyethoxy)ethoxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]-2-oxoethyl]-12-oxononadec-4-enoic acid.
| Compound Name | (2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(2-methoxyethoxy)ethoxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]-2-oxoethyl]-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 123303884 |
| Molecular Formula | C45H69NO14 |
| Molecular Weight | 848.04 g/mol |
| Exact Mass | 847.47 |
| IUPAC Name | (2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[2-(2-methoxyethoxy)ethoxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]-2-oxoethyl]-12-oxononadec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](C=CCCCCCCC(=O)CCCCCCC)[C@@](O)(CC(=O)OCCOCCOC)C(=O)O)C(=O)OCCOCCOC)cc1 |
| InChI | InChI=1S/C45H69NO14/c1-5-7-9-12-15-18-37(47)19-16-13-10-11-14-17-20-39(45(53,44(51)52)35-41(48)59-32-30-56-28-26-54-3)42(49)46-40(43(50)60-33-31-57-29-27-55-4)34-36-21-23-38(24-22-36)58-25-8-6-2/h17,20-24,39-40,53H,5,7,9-16,18-19,25-35H2,1-4H3,(H,46,49)(H,51,52)/t39-,40+,45+/m1/s1 |
| InChIKey | ZDMDMCVFMFWWNZ-UTWUQGRESA-N |
| XLogP | 5.18 |
| TPSA | 202.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|