C40H60N2O10 — CID 123221653
(2S,3S)-2-[2-(5-aminopentoxy)-2-oxoethyl]-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid (PubChem CID 123221653) has the molecular formula C40H60N2O10 and a molecular weight of 728.92 g/mol. Its IUPAC name is (2S,3S)-2-[2-(5-aminopentoxy)-2-oxoethyl]-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid.
| Compound Name | (2S,3S)-2-[2-(5-aminopentoxy)-2-oxoethyl]-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 123221653 |
| Molecular Formula | C40H60N2O10 |
| Molecular Weight | 728.92 g/mol |
| Exact Mass | 728.42 |
| IUPAC Name | (2S,3S)-2-[2-(5-aminopentoxy)-2-oxoethyl]-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](C=CCCCCCCC(=O)CCCCCCC)[C@@](O)(CC(=O)OCCCCCN)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C40H60N2O10/c1-3-5-7-10-14-19-32(43)20-15-11-8-9-12-16-21-34(40(50,39(48)49)30-36(44)52-28-18-13-17-26-41)37(45)42-35(38(46)47)29-31-22-24-33(25-23-31)51-27-6-4-2/h16,21-25,34-35,50H,3,5,7-15,17-20,26-30,41H2,1-2H3,(H,42,45)(H,46,47)(H,48,49)/t34-,35+,40+/m1/s1 |
| InChIKey | YNHONZTYJNVXNX-YXQOSMAKSA-N |
| XLogP | 5.52 |
| TPSA | 202.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.92 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|