C37H53NO10 — CID 5277668
(2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-hex-2-ynoxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 5277668) has the molecular formula C37H53NO10 and a molecular weight of 671.83 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-hex-2-ynoxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-hex-2-ynoxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 5277668 |
| Molecular Formula | C37H53NO10 |
| Molecular Weight | 671.83 g/mol |
| Exact Mass | 671.37 |
| IUPAC Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-hex-2-ynoxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C37H53NO10/c1-3-5-7-11-14-18-29(39)19-15-12-9-10-13-16-20-31(37(47,36(45)46)27-33(40)41)34(42)38-32(35(43)44)26-28-21-23-30(24-22-28)48-25-17-8-6-4-2/h16,20-24,31-32,47H,3-7,9-15,18-19,25-27H2,1-2H3,(H,38,42)(H,40,41)(H,43,44)(H,45,46)/b20-16+/t31-,32+,37+/m1/s1 |
| InChIKey | DYSLGEGOBDTOCJ-QUCOPCNJSA-N |
| XLogP | 5.71 |
| TPSA | 187.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|