C35H53NO10 — CID 5277615
(2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoheptadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 5277615) has the molecular formula C35H53NO10 and a molecular weight of 647.81 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoheptadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoheptadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 5277615 |
| Molecular Formula | C35H53NO10 |
| Molecular Weight | 647.81 g/mol |
| Exact Mass | 647.37 |
| IUPAC Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoheptadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OCCC(C)C)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C35H53NO10/c1-4-5-6-11-14-27(37)15-12-9-7-8-10-13-16-29(35(45,34(43)44)24-31(38)39)32(40)36-30(33(41)42)23-26-17-19-28(20-18-26)46-22-21-25(2)3/h13,16-20,25,29-30,45H,4-12,14-15,21-24H2,1-3H3,(H,36,40)(H,38,39)(H,41,42)(H,43,44)/b16-13+/t29-,30+,35+/m1/s1 |
| InChIKey | GEYRYKYKYSVOKV-CNMYIKHYSA-N |
| XLogP | 5.57 |
| TPSA | 187.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.81 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|