C41H58N2O10 — CID 135707746
(2S)-2-[(E,2R)-1-[[(1S)-2-[4-[3-(benzylamino)propoxy]phenyl]-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 135707746) has the molecular formula C41H58N2O10 and a molecular weight of 738.92 g/mol. Its IUPAC name is (2S)-2-[(E,2R)-1-[[(1S)-2-[4-[3-(benzylamino)propoxy]phenyl]-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2R)-1-[[(1S)-2-[4-[3-(benzylamino)propoxy]phenyl]-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 135707746 |
| Molecular Formula | C41H58N2O10 |
| Molecular Weight | 738.92 g/mol |
| Exact Mass | 738.41 |
| IUPAC Name | (2S)-2-[(E,2R)-1-[[(1S)-2-[4-[3-(benzylamino)propoxy]phenyl]-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@@H](C(=O)N[C@@H](Cc1ccc(OCCCNCc2ccccc2)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C41H58N2O10/c1-2-3-4-7-13-19-33(44)20-14-8-5-6-9-15-21-35(41(52,40(50)51)29-37(45)46)38(47)43-36(39(48)49)28-31-22-24-34(25-23-31)53-27-16-26-42-30-32-17-11-10-12-18-32/h10-12,15,17-18,21-25,35-36,42,52H,2-9,13-14,16,19-20,26-30H2,1H3,(H,43,47)(H,45,46)(H,48,49)(H,50,51)/b21-15+/t35-,36-,41-/m0/s1 |
| InChIKey | LYXIXGGUYKSIPC-ZNUXGHHKSA-N |
| XLogP | 6.09 |
| TPSA | 199.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.92 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|