C38H59NO10 — CID 123488896
(2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoicos-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 123488896) has the molecular formula C38H59NO10 and a molecular weight of 689.89 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoicos-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoicos-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 123488896 |
| Molecular Formula | C38H59NO10 |
| Molecular Weight | 689.89 g/mol |
| Exact Mass | 689.41 |
| IUPAC Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxoicos-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(OCCC(C)C)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C38H59NO10/c1-4-5-6-7-8-11-14-17-30(40)18-15-12-9-10-13-16-19-32(38(48,37(46)47)27-34(41)42)35(43)39-33(36(44)45)26-29-20-22-31(23-21-29)49-25-24-28(2)3/h16,19-23,28,32-33,48H,4-15,17-18,24-27H2,1-3H3,(H,39,43)(H,41,42)(H,44,45)(H,46,47)/t32-,33+,38+/m1/s1 |
| InChIKey | YRLOFSDTYLWKFU-GQNZDDNNSA-N |
| XLogP | 6.74 |
| TPSA | 187.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.89 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|