C37H57NO9 — CID 21158409
2-[(E)-1-[[1-carboxy-2-[4-(4-methylpentyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 21158409) has the molecular formula C37H57NO9 and a molecular weight of 659.86 g/mol. Its IUPAC name is 2-[(E)-1-[[1-carboxy-2-[4-(4-methylpentyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[(E)-1-[[1-carboxy-2-[4-(4-methylpentyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 21158409 |
| Molecular Formula | C37H57NO9 |
| Molecular Weight | 659.86 g/mol |
| Exact Mass | 659.40 |
| IUPAC Name | 2-[(E)-1-[[1-carboxy-2-[4-(4-methylpentyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)NC(Cc1ccc(CCCC(C)C)cc1)C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C37H57NO9/c1-4-5-6-9-12-18-30(39)19-13-10-7-8-11-14-20-31(37(47,36(45)46)26-33(40)41)34(42)38-32(35(43)44)25-29-23-21-28(22-24-29)17-15-16-27(2)3/h14,20-24,27,31-32,47H,4-13,15-19,25-26H2,1-3H3,(H,38,42)(H,40,41)(H,43,44)(H,45,46)/b20-14+ |
| InChIKey | KABGMXICPAMVIL-XSFVSMFZSA-N |
| XLogP | 6.51 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.86 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|