C37H48FNO9 — CID 5278939
(2S)-2-[(E,2R)-1-[[(1S)-1-carboxy-2-[4-(4-fluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 5278939) has the molecular formula C37H48FNO9 and a molecular weight of 669.79 g/mol. Its IUPAC name is (2S)-2-[(E,2R)-1-[[(1S)-1-carboxy-2-[4-(4-fluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2R)-1-[[(1S)-1-carboxy-2-[4-(4-fluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 5278939 |
| Molecular Formula | C37H48FNO9 |
| Molecular Weight | 669.79 g/mol |
| Exact Mass | 669.33 |
| IUPAC Name | (2S)-2-[(E,2R)-1-[[(1S)-1-carboxy-2-[4-(4-fluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@@H](C(=O)N[C@@H](Cc1ccc(-c2ccc(F)cc2)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C37H48FNO9/c1-2-3-4-7-10-13-30(40)14-11-8-5-6-9-12-15-31(37(48,36(46)47)25-33(41)42)34(43)39-32(35(44)45)24-26-16-18-27(19-17-26)28-20-22-29(38)23-21-28/h12,15-23,31-32,48H,2-11,13-14,24-25H2,1H3,(H,39,43)(H,41,42)(H,44,45)(H,46,47)/b15-12+/t31-,32-,37-/m0/s1 |
| InChIKey | KBRISUPXXYHWBZ-IEVXFXFISA-N |
| XLogP | 6.34 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.79 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|