C32H48N2O11S — CID 6320851
(2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(methanesulfonamido)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 6320851) has the molecular formula C32H48N2O11S and a molecular weight of 668.81 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(methanesulfonamido)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(methanesulfonamido)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 6320851 |
| Molecular Formula | C32H48N2O11S |
| Molecular Weight | 668.81 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(methanesulfonamido)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(NS(C)(=O)=O)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C32H48N2O11S/c1-3-4-5-8-11-14-25(35)15-12-9-6-7-10-13-16-26(32(43,31(41)42)22-28(36)37)29(38)33-27(30(39)40)21-23-17-19-24(20-18-23)34-46(2,44)45/h13,16-20,26-27,34,43H,3-12,14-15,21-22H2,1-2H3,(H,33,38)(H,36,37)(H,39,40)(H,41,42)/t26-,27+,32+/m1/s1 |
| InChIKey | QBANISXLTXTTFS-CUJVHAHTSA-N |
| XLogP | 3.90 |
| TPSA | 224.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|