C32H47NO10 — CID 10698909
2-hydroxy-2-[(E)-1-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid (PubChem CID 10698909) has the molecular formula C32H47NO10 and a molecular weight of 605.73 g/mol. Its IUPAC name is 2-hydroxy-2-[(E)-1-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[(E)-1-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid |
|---|---|
| PubChem CID | 10698909 |
| Molecular Formula | C32H47NO10 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | 2-hydroxy-2-[(E)-1-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)NC(Cc1ccc(O)cc1)C(=O)OC)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C32H47NO10/c1-3-4-5-8-11-14-24(34)15-12-9-6-7-10-13-16-26(32(42,31(40)41)22-28(36)37)29(38)33-27(30(39)43-2)21-23-17-19-25(35)20-18-23/h13,16-20,26-27,35,42H,3-12,14-15,21-22H2,1-2H3,(H,33,38)(H,36,37)(H,40,41)/b16-13+ |
| InChIKey | QFYTYMRGQGQQAI-DTQAZKPQSA-N |
| XLogP | 4.33 |
| TPSA | 187.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|