C31H45NO11 — CID 6320980
(2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-12-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 6320980) has the molecular formula C31H45NO11 and a molecular weight of 607.70 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-12-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-12-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 6320980 |
| Molecular Formula | C31H45NO11 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-12-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCC(O)C(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C31H45NO11/c1-2-3-4-10-13-25(34)26(35)14-11-8-6-5-7-9-12-23(31(43,30(41)42)20-27(36)37)28(38)32-24(29(39)40)19-21-15-17-22(33)18-16-21/h9,12,15-18,23-25,33-34,43H,2-8,10-11,13-14,19-20H2,1H3,(H,32,38)(H,36,37)(H,39,40)(H,41,42)/t23-,24+,25?,31+/m1/s1 |
| InChIKey | KYQBNVOUKLJJOV-ZIVCEQIKSA-N |
| XLogP | 3.21 |
| TPSA | 218.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|