C33H48N2O11 — CID 118263492
(2S)-2-[(E,2S)-1-[[(2S)-1-(carboxymethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 118263492) has the molecular formula C33H48N2O11 and a molecular weight of 648.75 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-1-[[(2S)-1-(carboxymethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2S)-1-[[(2S)-1-(carboxymethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 118263492 |
| Molecular Formula | C33H48N2O11 |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.33 |
| IUPAC Name | (2S)-2-[(E,2S)-1-[[(2S)-1-(carboxymethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C33H48N2O11/c1-2-3-4-7-10-13-24(36)14-11-8-5-6-9-12-15-26(33(46,32(44)45)21-28(38)39)30(42)35-27(31(43)34-22-29(40)41)20-23-16-18-25(37)19-17-23/h12,15-19,26-27,37,46H,2-11,13-14,20-22H2,1H3,(H,34,43)(H,35,42)(H,38,39)(H,40,41)(H,44,45)/b15-12+/t26-,27+,33+/m1/s1 |
| InChIKey | RPPDDLFMFOGCQD-JKJJJHSJSA-N |
| XLogP | 3.35 |
| TPSA | 227.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|