C34H54N2O9 — CID 118263528
(E,2S,3S)-2-hydroxy-3-[[(2S)-1-(2-hydroxyethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid (PubChem CID 118263528) has the molecular formula C34H54N2O9 and a molecular weight of 634.81 g/mol. Its IUPAC name is (E,2S,3S)-2-hydroxy-3-[[(2S)-1-(2-hydroxyethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-2-hydroxy-3-[[(2S)-1-(2-hydroxyethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118263528 |
| Molecular Formula | C34H54N2O9 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | (E,2S,3S)-2-hydroxy-3-[[(2S)-1-(2-hydroxyethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCO)[C@@](O)(CCOC)C(=O)O |
| InChI | InChI=1S/C34H54N2O9/c1-3-4-5-8-11-14-27(38)15-12-9-6-7-10-13-16-29(34(44,33(42)43)21-24-45-2)31(40)36-30(32(41)35-22-23-37)25-26-17-19-28(39)20-18-26/h13,16-20,29-30,37,39,44H,3-12,14-15,21-25H2,1-2H3,(H,35,41)(H,36,40)(H,42,43)/b16-13+/t29-,30+,34+/m1/s1 |
| InChIKey | OFIYISBWUZISNS-ATNVTZCWSA-N |
| XLogP | 3.82 |
| TPSA | 182.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|