C34H53NO8 — CID 118263523
(E,2S,3S)-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methylpropyl)-12-oxononadec-4-enoic acid (PubChem CID 118263523) has the molecular formula C34H53NO8 and a molecular weight of 603.80 g/mol. Its IUPAC name is (E,2S,3S)-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methylpropyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methylpropyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118263523 |
| Molecular Formula | C34H53NO8 |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.38 |
| IUPAC Name | (E,2S,3S)-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methylpropyl)-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OC)[C@@](O)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C34H53NO8/c1-5-6-7-10-13-16-27(36)17-14-11-8-9-12-15-18-29(34(42,33(40)41)24-25(2)3)31(38)35-30(32(39)43-4)23-26-19-21-28(37)22-20-26/h15,18-22,25,29-30,37,42H,5-14,16-17,23-24H2,1-4H3,(H,35,38)(H,40,41)/b18-15+/t29-,30+,34+/m1/s1 |
| InChIKey | DDZYTALSXDRGAQ-YSKPUFIBSA-N |
| XLogP | 5.90 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|