C38H57NO10 — CID 21158396
(E)-2-hydroxy-3-[[1-methoxy-3-[4-(3-methylbut-2-enoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid (PubChem CID 21158396) has the molecular formula C38H57NO10 and a molecular weight of 687.87 g/mol. Its IUPAC name is (E)-2-hydroxy-3-[[1-methoxy-3-[4-(3-methylbut-2-enoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E)-2-hydroxy-3-[[1-methoxy-3-[4-(3-methylbut-2-enoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 21158396 |
| Molecular Formula | C38H57NO10 |
| Molecular Weight | 687.87 g/mol |
| Exact Mass | 687.40 |
| IUPAC Name | (E)-2-hydroxy-3-[[1-methoxy-3-[4-(3-methylbut-2-enoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)NC(Cc1ccc(OCC=C(C)C)cc1)C(=O)OC)C(O)(CC(=O)OC)C(=O)O |
| InChI | InChI=1S/C38H57NO10/c1-6-7-8-11-14-17-30(40)18-15-12-9-10-13-16-19-32(38(46,37(44)45)27-34(41)47-4)35(42)39-33(36(43)48-5)26-29-20-22-31(23-21-29)49-25-24-28(2)3/h16,19-24,32-33,46H,6-15,17-18,25-27H2,1-5H3,(H,39,42)(H,44,45)/b19-16+ |
| InChIKey | JNRHMJOGCQXDPG-KNTRCKAVSA-N |
| XLogP | 6.05 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|