C36H55N3O8 — CID 123937321
(2S)-2-[[(2S)-2-[(2S)-1,4-diamino-2-hydroxy-1,4-dioxobutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methylbut-2-enoxy)phenyl]propanoic acid (PubChem CID 123937321) has the molecular formula C36H55N3O8 and a molecular weight of 657.85 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2S)-1,4-diamino-2-hydroxy-1,4-dioxobutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methylbut-2-enoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(2S)-1,4-diamino-2-hydroxy-1,4-dioxobutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methylbut-2-enoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 123937321 |
| Molecular Formula | C36H55N3O8 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.40 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2S)-1,4-diamino-2-hydroxy-1,4-dioxobutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methylbut-2-enoxy)phenyl]propanoic acid |
| SMILES | CCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(OCC=C(C)C)cc1)C(=O)O)[C@@](O)(CC(N)=O)C(N)=O |
| InChI | InChI=1S/C36H55N3O8/c1-4-5-6-9-12-15-28(40)16-13-10-7-8-11-14-17-30(36(46,35(38)45)25-32(37)41)33(42)39-31(34(43)44)24-27-18-20-29(21-19-27)47-23-22-26(2)3/h14,17-22,30-31,46H,4-13,15-16,23-25H2,1-3H3,(H2,37,41)(H2,38,45)(H,39,42)(H,43,44)/t30-,31+,36+/m1/s1 |
| InChIKey | JUFDCXVOMQXCSR-IJXWMGFQSA-N |
| XLogP | 4.68 |
| TPSA | 199.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|