C38H59N3O10 — CID 6320989
(2S)-2-[(2S)-11-(2-aminoethoxyimino)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 6320989) has the molecular formula C38H59N3O10 and a molecular weight of 717.90 g/mol. Its IUPAC name is (2S)-2-[(2S)-11-(2-aminoethoxyimino)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-11-(2-aminoethoxyimino)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 6320989 |
| Molecular Formula | C38H59N3O10 |
| Molecular Weight | 717.90 g/mol |
| Exact Mass | 717.42 |
| IUPAC Name | (2S)-2-[(2S)-11-(2-aminoethoxyimino)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(OCC=C(C)C)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O)=NOCCN |
| InChI | InChI=1S/C38H59N3O10/c1-4-5-6-9-12-15-30(41-51-25-23-39)16-13-10-7-8-11-14-17-32(38(49,37(47)48)27-34(42)43)35(44)40-33(36(45)46)26-29-18-20-31(21-19-29)50-24-22-28(2)3/h14,17-22,32-33,49H,4-13,15-16,23-27,39H2,1-3H3,(H,40,44)(H,42,43)(H,45,46)(H,47,48)/t32-,33+,38+/m1/s1 |
| InChIKey | UDUVVVXZVRJJFY-GQNZDDNNSA-N |
| XLogP | 5.64 |
| TPSA | 218.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|