C36H53NO11 — CID 11643266
(2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-13-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 11643266) has the molecular formula C36H53NO11 and a molecular weight of 675.82 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-13-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-13-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 11643266 |
| Molecular Formula | C36H53NO11 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethyl]amino]-13-hydroxy-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCC(O)CC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OCC=C(C)C)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C36H53NO11/c1-4-5-10-13-27(38)23-28(39)14-11-8-6-7-9-12-15-30(36(47,35(45)46)24-32(40)41)33(42)37-31(34(43)44)22-26-16-18-29(19-17-26)48-21-20-25(2)3/h12,15-20,27,30-31,38,47H,4-11,13-14,21-24H2,1-3H3,(H,37,42)(H,40,41)(H,43,44)(H,45,46)/b15-12+/t27?,30-,31+,36+/m1/s1 |
| InChIKey | KFXMVQOGMWXEMK-PMTOPPFFSA-N |
| XLogP | 4.85 |
| TPSA | 207.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|