C40H64N2O9 — CID 123518275
tert-butyl (2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate (PubChem CID 123518275) has the molecular formula C40H64N2O9 and a molecular weight of 716.96 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate.
| Compound Name | tert-butyl (2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 123518275 |
| Molecular Formula | C40H64N2O9 |
| Molecular Weight | 716.96 g/mol |
| Exact Mass | 716.46 |
| IUPAC Name | tert-butyl (2S,3S)-2-(2-amino-2-oxoethyl)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate |
| SMILES | CCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(OCCCC)cc1)C(=O)OC)[C@@](O)(CC(N)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H64N2O9/c1-7-9-11-14-17-20-31(43)21-18-15-12-13-16-19-22-33(40(48,29-35(41)44)38(47)51-39(3,4)5)36(45)42-34(37(46)49-6)28-30-23-25-32(26-24-30)50-27-10-8-2/h19,22-26,33-34,48H,7-18,20-21,27-29H2,1-6H3,(H2,41,44)(H,42,45)/t33-,34+,40+/m1/s1 |
| InChIKey | VTMLHIOLTRXJTE-OCIHUODESA-N |
| XLogP | 6.46 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.96 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|