C36H56FNO8 — CID 90060215
(E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-fluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid (PubChem CID 90060215) has the molecular formula C36H56FNO8 and a molecular weight of 649.84 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-fluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-fluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 90060215 |
| Molecular Formula | C36H56FNO8 |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.40 |
| IUPAC Name | (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-fluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OCCCC)cc1)C(=O)OC)[C@@](O)(CCF)C(=O)O |
| InChI | InChI=1S/C36H56FNO8/c1-4-6-8-11-14-17-29(39)18-15-12-9-10-13-16-19-31(36(44,24-25-37)35(42)43)33(40)38-32(34(41)45-3)27-28-20-22-30(23-21-28)46-26-7-5-2/h16,19-23,31-32,44H,4-15,17-18,24-27H2,1-3H3,(H,38,40)(H,42,43)/b19-16+/t31-,32+,36+/m1/s1 |
| InChIKey | YTDVITBHIMPUAT-CPFYJJDLSA-N |
| XLogP | 6.68 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|