C36H56F2N2O7 — CID 118157360
(E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid (PubChem CID 118157360) has the molecular formula C36H56F2N2O7 and a molecular weight of 666.85 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118157360 |
| Molecular Formula | C36H56F2N2O7 |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.41 |
| IUPAC Name | (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-2-hydroxy-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OCCCC)cc1)C(=O)NC)[C@@](O)(CC(F)F)C(=O)O |
| InChI | InChI=1S/C36H56F2N2O7/c1-4-6-8-11-14-17-28(41)18-15-12-9-10-13-16-19-30(36(46,35(44)45)26-32(37)38)33(42)40-31(34(43)39-3)25-27-20-22-29(23-21-27)47-24-7-5-2/h16,19-23,30-32,46H,4-15,17-18,24-26H2,1-3H3,(H,39,43)(H,40,42)(H,44,45)/b19-16+/t30-,31+,36+/m1/s1 |
| InChIKey | HOHLNPSYKZKUQB-LOQQGKBVSA-N |
| XLogP | 6.55 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|