C35H55FN2O7 — CID 90060232
(E,2S,3S)-3-[[(2S)-1-amino-3-[4-(3-fluoropropoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoic acid (PubChem CID 90060232) has the molecular formula C35H55FN2O7 and a molecular weight of 634.83 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(2S)-1-amino-3-[4-(3-fluoropropoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(2S)-1-amino-3-[4-(3-fluoropropoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoic acid |
|---|---|
| PubChem CID | 90060232 |
| Molecular Formula | C35H55FN2O7 |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.40 |
| IUPAC Name | (E,2S,3S)-3-[[(2S)-1-amino-3-[4-(3-fluoropropoxy)phenyl]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxo-2-propylnonadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OCCCF)cc1)C(N)=O)[C@@](O)(CCC)C(=O)O |
| InChI | InChI=1S/C35H55FN2O7/c1-3-5-6-9-12-16-28(39)17-13-10-7-8-11-14-18-30(35(44,23-4-2)34(42)43)33(41)38-31(32(37)40)26-27-19-21-29(22-20-27)45-25-15-24-36/h14,18-22,30-31,44H,3-13,15-17,23-26H2,1-2H3,(H2,37,40)(H,38,41)(H,42,43)/b18-14+/t30-,31+,35+/m1/s1 |
| InChIKey | ZGYDLCPEYXIRSC-IONCBNJTSA-N |
| XLogP | 6.00 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|