C35H54FNO9 — CID 90060231
(E,2S,3S)-3-[[(1S)-1-carboxy-2-[4-(3-fluoropropoxy)phenyl]ethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid (PubChem CID 90060231) has the molecular formula C35H54FNO9 and a molecular weight of 651.81 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(1S)-1-carboxy-2-[4-(3-fluoropropoxy)phenyl]ethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(1S)-1-carboxy-2-[4-(3-fluoropropoxy)phenyl]ethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 90060231 |
| Molecular Formula | C35H54FNO9 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | (E,2S,3S)-3-[[(1S)-1-carboxy-2-[4-(3-fluoropropoxy)phenyl]ethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OCCCF)cc1)C(=O)O)[C@@](O)(CCOC)C(=O)O |
| InChI | InChI=1S/C35H54FNO9/c1-3-4-5-8-11-15-28(38)16-12-9-6-7-10-13-17-30(35(44,34(42)43)22-25-45-2)32(39)37-31(33(40)41)26-27-18-20-29(21-19-27)46-24-14-23-36/h13,17-21,30-31,44H,3-12,14-16,22-26H2,1-2H3,(H,37,39)(H,40,41)(H,42,43)/b17-13+/t30-,31+,35+/m1/s1 |
| InChIKey | RNELRZUWFCDEIT-VERPQKLJSA-N |
| XLogP | 5.83 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|