C36H53NO9 — CID 123954516
(2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid (PubChem CID 123954516) has the molecular formula C36H53NO9 and a molecular weight of 643.82 g/mol. Its IUPAC name is (2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 123954516 |
| Molecular Formula | C36H53NO9 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.37 |
| IUPAC Name | (2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](C=CCCCCCCC(=O)CCCCCCC)[C@@](O)(CCOC)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C36H53NO9/c1-4-6-8-11-14-17-29(38)18-15-12-9-10-13-16-19-31(36(44,35(42)43)24-26-45-3)33(39)37-32(34(40)41)27-28-20-22-30(23-21-28)46-25-7-5-2/h16,19-23,31-32,44H,4,6,8-15,17-18,24-27H2,1-3H3,(H,37,39)(H,40,41)(H,42,43)/t31-,32+,36+/m1/s1 |
| InChIKey | NRSJBGRRXXAKIF-QCNZEISBSA-N |
| XLogP | 5.50 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|