C36H55NO8 — CID 118157434
(E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptoxy-2-hydroxy-2-propylundec-4-enoic acid (PubChem CID 118157434) has the molecular formula C36H55NO8 and a molecular weight of 629.84 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptoxy-2-hydroxy-2-propylundec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptoxy-2-hydroxy-2-propylundec-4-enoic acid |
|---|---|
| PubChem CID | 118157434 |
| Molecular Formula | C36H55NO8 |
| Molecular Weight | 629.84 g/mol |
| Exact Mass | 629.39 |
| IUPAC Name | (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptoxy-2-hydroxy-2-propylundec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCOCCCCCCC)[C@@](O)(CCC)C(=O)O)C(=O)OC)cc1 |
| InChI | InChI=1S/C36H55NO8/c1-5-8-10-14-17-25-44-26-18-15-12-11-13-16-19-31(36(42,24-7-3)35(40)41)33(38)37-32(34(39)43-4)28-29-20-22-30(23-21-29)45-27-9-6-2/h16,19-23,31-32,42H,5,7-8,10-15,17-18,24-28H2,1-4H3,(H,37,38)(H,40,41)/b19-16+/t31-,32+,36+/m1/s1 |
| InChIKey | PXFKXOPLQZGELS-CPFYJJDLSA-N |
| XLogP | 6.01 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.84 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|