C36H55NO8S — CID 118157598
(E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfanyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoic acid (PubChem CID 118157598) has the molecular formula C36H55NO8S and a molecular weight of 661.90 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfanyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfanyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoic acid |
|---|---|
| PubChem CID | 118157598 |
| Molecular Formula | C36H55NO8S |
| Molecular Weight | 661.90 g/mol |
| Exact Mass | 661.36 |
| IUPAC Name | (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfanyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCSCCCCCCC)[C@@](O)(CCOC)C(=O)O)C(=O)OC)cc1 |
| InChI | InChI=1S/C36H55NO8S/c1-5-7-9-13-16-26-46-27-17-14-11-10-12-15-18-31(36(42,35(40)41)23-25-43-3)33(38)37-32(34(39)44-4)28-29-19-21-30(22-20-29)45-24-8-6-2/h15,18-22,31-32,42H,5,7,9-14,16-17,23-28H2,1-4H3,(H,37,38)(H,40,41)/b18-15+/t31-,32+,36+/m1/s1 |
| InChIKey | JWEMVOQNYPUXBB-DFOLXMFBSA-N |
| XLogP | 5.97 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.90 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|