C38H55F2NO9 — CID 118157820
(E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoic acid (PubChem CID 118157820) has the molecular formula C38H55F2NO9 and a molecular weight of 707.85 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoic acid |
|---|---|
| PubChem CID | 118157820 |
| Molecular Formula | C38H55F2NO9 |
| Molecular Weight | 707.85 g/mol |
| Exact Mass | 707.38 |
| IUPAC Name | (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)C(/C=C/CCCCCCC2(CCCCCCC)OCCO2)[C@@](O)(CC(F)F)C(=O)O)C(=O)OC)cc1 |
| InChI | InChI=1S/C38H55F2NO9/c1-4-6-8-12-15-22-37(49-25-26-50-37)23-16-13-10-9-11-14-17-31(38(46,36(44)45)28-33(39)40)34(42)41-32(35(43)47-3)27-29-18-20-30(21-19-29)48-24-7-5-2/h14,17-21,31-33,46H,4,6,8-13,15-16,22-28H2,1-3H3,(H,41,42)(H,44,45)/b17-14+/t31?,32-,38-/m0/s1 |
| InChIKey | VYJBECLOJDUEJR-RUIWLXJYSA-N |
| XLogP | 6.38 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.85 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|