C38H59F2N2O8- — CID 154438860
(E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate (PubChem CID 154438860) has the molecular formula C38H59F2N2O8- and a molecular weight of 709.89 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate.
| Compound Name | (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate |
|---|---|
| PubChem CID | 154438860 |
| Molecular Formula | C38H59F2N2O8- |
| Molecular Weight | 709.89 g/mol |
| Exact Mass | 709.42 |
| IUPAC Name | (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate |
| SMILES | CCCCCCCC1(CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc2ccc(OCCCC)cc2)C(=O)NC)[C@@](O)(CC(F)F)C(=O)[O-])OCCO1 |
| InChI | InChI=1S/C38H60F2N2O8/c1-4-6-8-12-15-22-37(49-25-26-50-37)23-16-13-10-9-11-14-17-31(38(47,36(45)46)28-33(39)40)34(43)42-32(35(44)41-3)27-29-18-20-30(21-19-29)48-24-7-5-2/h14,17-21,31-33,47H,4-13,15-16,22-28H2,1-3H3,(H,41,44)(H,42,43)(H,45,46)/p-1/b17-14+/t31-,32+,38+/m1/s1 |
| InChIKey | YYKMKQRPSNHPMJ-GTOVMNANSA-M |
| XLogP | 5.39 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|