C36H56F4N2O6 — CID 154301595
(2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-12,12-difluoro-2-hydroxynonadec-4-enoic acid (PubChem CID 154301595) has the molecular formula C36H56F4N2O6 and a molecular weight of 688.84 g/mol. Its IUPAC name is (2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-12,12-difluoro-2-hydroxynonadec-4-enoic acid.
| Compound Name | (2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-12,12-difluoro-2-hydroxynonadec-4-enoic acid |
|---|---|
| PubChem CID | 154301595 |
| Molecular Formula | C36H56F4N2O6 |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.41 |
| IUPAC Name | (2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-2-(2,2-difluoroethyl)-12,12-difluoro-2-hydroxynonadec-4-enoic acid |
| SMILES | CCCCCCCC(F)(F)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(OCCCC)cc1)C(=O)NC)[C@@](O)(CC(F)F)C(=O)O |
| InChI | InChI=1S/C36H56F4N2O6/c1-4-6-8-12-15-22-35(39,40)23-16-13-10-9-11-14-17-29(36(47,34(45)46)26-31(37)38)32(43)42-30(33(44)41-3)25-27-18-20-28(21-19-27)48-24-7-5-2/h14,17-21,29-31,47H,4-13,15-16,22-26H2,1-3H3,(H,41,44)(H,42,43)(H,45,46)/t29-,30+,36+/m1/s1 |
| InChIKey | BEPOZXNCBSYVDD-ZMAZKXACSA-N |
| XLogP | 7.62 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|