C40H59F2NO11 — CID 118260245
(5-methyl-2-oxo-1,3-dioxol-4-yl) (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12,12-difluoro-2-hydroxy-2-(2-methoxyethyl)octadec-4-enoate (PubChem CID 118260245) has the molecular formula C40H59F2NO11 and a molecular weight of 767.90 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl) (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12,12-difluoro-2-hydroxy-2-(2-methoxyethyl)octadec-4-enoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl) (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12,12-difluoro-2-hydroxy-2-(2-methoxyethyl)octadec-4-enoate |
|---|---|
| PubChem CID | 118260245 |
| Molecular Formula | C40H59F2NO11 |
| Molecular Weight | 767.90 g/mol |
| Exact Mass | 767.41 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl) (E,2S,3S)-3-[[(2S)-3-(4-butoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12,12-difluoro-2-hydroxy-2-(2-methoxyethyl)octadec-4-enoate |
| SMILES | CCCCCCC(F)(F)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OCCCC)cc1)C(=O)OC)[C@@](O)(CCOC)C(=O)Oc1oc(=O)oc1C |
| InChI | InChI=1S/C40H59F2NO11/c1-6-8-10-16-23-39(41,42)24-17-14-12-11-13-15-18-32(40(48,25-27-49-4)37(46)53-36-29(3)52-38(47)54-36)34(44)43-33(35(45)50-5)28-30-19-21-31(22-20-30)51-26-9-7-2/h15,18-22,32-33,48H,6-14,16-17,23-28H2,1-5H3,(H,43,44)/b18-15+/t32-,33+,40+/m1/s1 |
| InChIKey | BIYLFBUNNNSLMQ-ZGXKEJTASA-N |
| XLogP | 7.41 |
| TPSA | 163.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.90 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|