C36H59NO8S — CID 118263464
tert-butyl (E,2S,3S)-11-heptylsulfanyl-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)undec-4-enoate (PubChem CID 118263464) has the molecular formula C36H59NO8S and a molecular weight of 665.93 g/mol. Its IUPAC name is tert-butyl (E,2S,3S)-11-heptylsulfanyl-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)undec-4-enoate.
| Compound Name | tert-butyl (E,2S,3S)-11-heptylsulfanyl-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)undec-4-enoate |
|---|---|
| PubChem CID | 118263464 |
| Molecular Formula | C36H59NO8S |
| Molecular Weight | 665.93 g/mol |
| Exact Mass | 665.40 |
| IUPAC Name | tert-butyl (E,2S,3S)-11-heptylsulfanyl-2-hydroxy-3-[[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxyethyl)undec-4-enoate |
| SMILES | CCCCCCCSCCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OC)[C@@](O)(CCOC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H59NO8S/c1-7-8-9-13-16-25-46-26-17-14-11-10-12-15-18-30(36(42,23-24-43-5)34(41)45-35(2,3)4)32(39)37-31(33(40)44-6)27-28-19-21-29(38)22-20-28/h15,18-22,30-31,38,42H,7-14,16-17,23-27H2,1-6H3,(H,37,39)/b18-15+/t30-,31+,36+/m1/s1 |
| InChIKey | UWIMIFATDWEMOW-YSFPVVQKSA-N |
| XLogP | 6.53 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.93 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|