C33H49NO10 — CID 10817650
(E)-2-hydroxy-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid (PubChem CID 10817650) has the molecular formula C33H49NO10 and a molecular weight of 619.75 g/mol. Its IUPAC name is (E)-2-hydroxy-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E)-2-hydroxy-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 10817650 |
| Molecular Formula | C33H49NO10 |
| Molecular Weight | 619.75 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | (E)-2-hydroxy-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-(2-methoxy-2-oxoethyl)-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)NC(Cc1ccc(O)cc1)C(=O)OC)C(O)(CC(=O)OC)C(=O)O |
| InChI | InChI=1S/C33H49NO10/c1-4-5-6-9-12-15-25(35)16-13-10-7-8-11-14-17-27(33(42,32(40)41)23-29(37)43-2)30(38)34-28(31(39)44-3)22-24-18-20-26(36)21-19-24/h14,17-21,27-28,36,42H,4-13,15-16,22-23H2,1-3H3,(H,34,38)(H,40,41)/b17-14+ |
| InChIKey | AAPZPIJOBIIDFA-SAPNQHFASA-N |
| XLogP | 4.41 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|