C36H57NO9 — CID 118263419
tert-butyl (E,2R,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12-oxononadec-4-enoate (PubChem CID 118263419) has the molecular formula C36H57NO9 and a molecular weight of 647.85 g/mol. Its IUPAC name is tert-butyl (E,2R,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12-oxononadec-4-enoate.
| Compound Name | tert-butyl (E,2R,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 118263419 |
| Molecular Formula | C36H57NO9 |
| Molecular Weight | 647.85 g/mol |
| Exact Mass | 647.40 |
| IUPAC Name | tert-butyl (E,2R,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-12-oxononadec-4-enoate |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)NC(Cc1ccc(O)cc1)C(=O)OC)[C@](O)(CCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H57NO9/c1-6-7-8-11-14-17-28(39)18-15-12-9-10-13-16-19-30(36(44,24-25-38)34(43)46-35(2,3)4)32(41)37-31(33(42)45-5)26-27-20-22-29(40)23-21-27/h16,19-23,30-31,38,40,44H,6-15,17-18,24-26H2,1-5H3,(H,37,41)/b19-16+/t30-,31?,36-/m1/s1 |
| InChIKey | JPHBFOISIKVQIW-BSHCVTFASA-N |
| XLogP | 5.49 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.85 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|