C38H58N2O8 — CID 123571495
tert-butyl (2S,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[(1S)-2-(4-hydroxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-12-oxononadec-4-enoate (PubChem CID 123571495) has the molecular formula C38H58N2O8 and a molecular weight of 670.89 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[(1S)-2-(4-hydroxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-12-oxononadec-4-enoate.
| Compound Name | tert-butyl (2S,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[(1S)-2-(4-hydroxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 123571495 |
| Molecular Formula | C38H58N2O8 |
| Molecular Weight | 670.89 g/mol |
| Exact Mass | 670.42 |
| IUPAC Name | tert-butyl (2S,3S)-2-hydroxy-2-(2-hydroxyethyl)-3-[[(1S)-2-(4-hydroxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-12-oxononadec-4-enoate |
| SMILES | CCCCCCCC(=O)CCCCCCC=CC(C(=O)N[C@@H](Cc1ccc(O)cc1)c1ncc(C)o1)[C@@](O)(CCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H58N2O8/c1-6-7-8-11-14-17-30(42)18-15-12-9-10-13-16-19-32(38(46,24-25-41)36(45)48-37(3,4)5)34(44)40-33(35-39-27-28(2)47-35)26-29-20-22-31(43)23-21-29/h16,19-23,27,32-33,41,43,46H,6-15,17-18,24-26H2,1-5H3,(H,40,44)/t32?,33-,38-/m0/s1 |
| InChIKey | INWAESPNROTBCG-FJLIVAQUSA-N |
| XLogP | 6.99 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.89 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|