C38H54N2O8 — CID 90060466
(E,2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid (PubChem CID 90060466) has the molecular formula C38H54N2O8 and a molecular weight of 666.86 g/mol. Its IUPAC name is (E,2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 90060466 |
| Molecular Formula | C38H54N2O8 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | (E,2S,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-(5-methyl-1,3-oxazol-2-yl)ethyl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)C(/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CCO)C(=O)O)c2ncc(C)o2)cc1 |
| InChI | InChI=1S/C38H54N2O8/c1-4-6-8-11-14-17-31(42)18-15-12-9-10-13-16-19-33(38(46,24-25-41)37(44)45)35(43)40-34(36-39-28-29(3)48-36)27-30-20-22-32(23-21-30)47-26-7-5-2/h16,19-23,28,33-34,41,46H,4,6,8-15,17-18,24-27H2,1-3H3,(H,40,43)(H,44,45)/b19-16+/t33?,34-,38-/m0/s1 |
| InChIKey | GBTQEBWVLWPVFO-IHINVPJXSA-N |
| XLogP | 6.43 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|