C36H55NO9 — CID 90060138
(E,2S,3S)-3-[[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-hydroxymethyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid (PubChem CID 90060138) has the molecular formula C36H55NO9 and a molecular weight of 645.83 g/mol. Its IUPAC name is (E,2S,3S)-3-[[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-hydroxymethyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-hydroxymethyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 90060138 |
| Molecular Formula | C36H55NO9 |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.39 |
| IUPAC Name | (E,2S,3S)-3-[[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-hydroxymethyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CCO)C(=O)O)C(=O)OC)cc1 |
| InChI | InChI=1S/C36H55NO9/c1-4-6-8-11-14-17-29(39)18-15-12-9-10-13-16-19-31(36(44,24-25-38)35(42)43)33(40)37-32(34(41)45-3)27-28-20-22-30(23-21-28)46-26-7-5-2/h16,19-23,31-33,37-38,40,44H,4,6,8-15,17-18,24-27H2,1-3H3,(H,42,43)/b19-16+/t31-,32+,33?,36+/m1/s1 |
| InChIKey | JWHVAGPRFPIVMM-FBOXJLKFSA-N |
| XLogP | 4.72 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|