C43H67NO9 — CID 123303760
tert-butyl (2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoate (PubChem CID 123303760) has the molecular formula C43H67NO9 and a molecular weight of 742.01 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoate.
| Compound Name | tert-butyl (2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 123303760 |
| Molecular Formula | C43H67NO9 |
| Molecular Weight | 742.01 g/mol |
| Exact Mass | 741.48 |
| IUPAC Name | tert-butyl (2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-2-(2-hydroxyethyl)-12-oxononadec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](C=CCCCCCCC(=O)CCCCCCC)[C@@](O)(CCO)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C43H67NO9/c1-9-11-13-16-19-22-34(46)23-20-17-14-15-18-21-24-36(43(50,29-30-45)40(49)53-42(6,7)8)38(47)44-37(39(48)52-41(3,4)5)32-33-25-27-35(28-26-33)51-31-12-10-2/h21,24-28,36-37,45,50H,9,11,13-20,22-23,29-32H2,1-8H3,(H,44,47)/t36-,37+,43+/m1/s1 |
| InChIKey | IYDSLQIAARQWGD-YWYFBRAESA-N |
| XLogP | 7.36 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.01 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|