C40H64N2O9S — CID 90060227
tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-10-(octylsulfonylamino)-2-propyldec-4-enoate (PubChem CID 90060227) has the molecular formula C40H64N2O9S and a molecular weight of 749.02 g/mol. Its IUPAC name is tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-10-(octylsulfonylamino)-2-propyldec-4-enoate.
| Compound Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-10-(octylsulfonylamino)-2-propyldec-4-enoate |
|---|---|
| PubChem CID | 90060227 |
| Molecular Formula | C40H64N2O9S |
| Molecular Weight | 749.02 g/mol |
| Exact Mass | 748.43 |
| IUPAC Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-10-(octylsulfonylamino)-2-propyldec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCNS(=O)(=O)CCCCCCCC)[C@@](O)(CCC)C(=O)OC(C)(C)C)C(=O)OC)cc1 |
| InChI | InChI=1S/C40H64N2O9S/c1-8-11-13-14-18-21-30-52(47,48)41-28-20-17-15-16-19-22-34(40(46,27-10-3)38(45)51-39(4,5)6)36(43)42-35(37(44)49-7)31-32-23-25-33(26-24-32)50-29-12-9-2/h19,22-26,34-35,41,46H,8,10-11,13-18,20-21,27-31H2,1-7H3,(H,42,43)/b22-19+/t34-,35+,40+/m1/s1 |
| InChIKey | PITUTDPDUSBOIA-IWIXMASTSA-N |
| XLogP | 6.17 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.02 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|