C46H65NO9 — CID 131734870
tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-11-[2-(4-phenylbutyl)-1,3-dioxolan-2-yl]-2-propylundec-4-enoate (PubChem CID 131734870) has the molecular formula C46H65NO9 and a molecular weight of 776.02 g/mol. Its IUPAC name is tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-11-[2-(4-phenylbutyl)-1,3-dioxolan-2-yl]-2-propylundec-4-enoate.
| Compound Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-11-[2-(4-phenylbutyl)-1,3-dioxolan-2-yl]-2-propylundec-4-enoate |
|---|---|
| PubChem CID | 131734870 |
| Molecular Formula | C46H65NO9 |
| Molecular Weight | 776.02 g/mol |
| Exact Mass | 775.47 |
| IUPAC Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-11-[2-(4-phenylbutyl)-1,3-dioxolan-2-yl]-2-propylundec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)C(/C=C/CCCCCCC2(CCCCc3ccccc3)OCCO2)[C@@](O)(CCC)C(=O)OC(C)(C)C)C(=O)OC)cc1 |
| InChI | InChI=1S/C46H65NO9/c1-7-9-32-53-38-27-25-37(26-28-38)35-40(42(49)52-6)47-41(48)39(46(51,29-8-2)43(50)56-44(3,4)5)24-17-12-10-11-13-19-30-45(54-33-34-55-45)31-20-18-23-36-21-15-14-16-22-36/h14-17,21-22,24-28,39-40,51H,8,10-13,18-20,23,29-35H2,1-6H3,(H,47,48)/b24-17+/t39?,40-,46-/m0/s1 |
| InChIKey | KCJOBTLGFDPAQW-KZCVCNBYSA-N |
| XLogP | 7.83 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.02 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|